C15H22BrClN4O2 — CID 86695607
tert-butyl N-[[1-[(5-bromo-2-chloropyrimidin-4-yl)amino]cyclopentyl]methyl]carbamate (PubChem CID 86695607) has the molecular formula C15H22BrClN4O2 and a molecular weight of 405.72 g/mol. Its IUPAC name is tert-butyl N-[[1-[(5-bromo-2-chloropyrimidin-4-yl)amino]cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[(5-bromo-2-chloropyrimidin-4-yl)amino]cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 86695607 |
| Molecular Formula | C15H22BrClN4O2 |
| Molecular Weight | 405.72 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | tert-butyl N-[[1-[(5-bromo-2-chloropyrimidin-4-yl)amino]cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(Nc2nc(Cl)ncc2Br)CCCC1 |
| InChI | InChI=1S/C15H22BrClN4O2/c1-14(2,3)23-13(22)19-9-15(6-4-5-7-15)21-11-10(16)8-18-12(17)20-11/h8H,4-7,9H2,1-3H3,(H,19,22)(H,18,20,21) |
| InChIKey | PHGHAVJLXOYDFG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |