C16H24ClFN4O2 — CID 59845697
tert-butyl N-[4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]carbamate (PubChem CID 59845697) has the molecular formula C16H24ClFN4O2 and a molecular weight of 358.85 g/mol. Its IUPAC name is tert-butyl N-[4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 59845697 |
| Molecular Formula | C16H24ClFN4O2 |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | tert-butyl N-[4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CNc2nc(Cl)ncc2F)CC1 |
| InChI | InChI=1S/C16H24ClFN4O2/c1-16(2,3)24-15(23)21-11-6-4-10(5-7-11)8-19-13-12(18)9-20-14(17)22-13/h9-11H,4-8H2,1-3H3,(H,21,23)(H,19,20,22) |
| InChIKey | SNSGSLXXBCFADG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |