C19H27ClN4O3 — CID 162360184
tert-butyl N-[3-[2-chloro-4-[[1-(hydroxymethyl)cyclohexyl]amino]pyrimidin-5-yl]prop-2-ynyl]carbamate (PubChem CID 162360184) has the molecular formula C19H27ClN4O3 and a molecular weight of 394.90 g/mol. Its IUPAC name is tert-butyl N-[3-[2-chloro-4-[[1-(hydroxymethyl)cyclohexyl]amino]pyrimidin-5-yl]prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-chloro-4-[[1-(hydroxymethyl)cyclohexyl]amino]pyrimidin-5-yl]prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 162360184 |
| Molecular Formula | C19H27ClN4O3 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | tert-butyl N-[3-[2-chloro-4-[[1-(hydroxymethyl)cyclohexyl]amino]pyrimidin-5-yl]prop-2-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC#Cc1cnc(Cl)nc1NC1(CO)CCCCC1 |
| InChI | InChI=1S/C19H27ClN4O3/c1-18(2,3)27-17(26)21-11-7-8-14-12-22-16(20)23-15(14)24-19(13-25)9-5-4-6-10-19/h12,25H,4-6,9-11,13H2,1-3H3,(H,21,26)(H,22,23,24) |
| InChIKey | KYKXEAMCTGKLPD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|