C20H30ClN5O3 — CID 90052758
tert-butyl N-[(2S)-1-[5-[2-chloro-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 90052758) has the molecular formula C20H30ClN5O3 and a molecular weight of 423.95 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[5-[2-chloro-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[5-[2-chloro-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 90052758 |
| Molecular Formula | C20H30ClN5O3 |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | tert-butyl N-[(2S)-1-[5-[2-chloro-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCNc1nc(Cl)ncc1C#CCCCNC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30ClN5O3/c1-6-11-22-16-15(13-24-18(21)26-16)10-8-7-9-12-23-17(27)14(2)25-19(28)29-20(3,4)5/h13-14H,6-7,9,11-12H2,1-5H3,(H,23,27)(H,25,28)(H,22,24,26)/t14-/m0/s1 |
| InChIKey | MWRZRMSDHCKTOD-AWEZNQCLSA-N |
| XLogP | 3.11 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|