C24H38N6O3 — CID 90052577
tert-butyl N-[(2S)-1-[5-[2-(cyclopropylamino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylcarbamate (PubChem CID 90052577) has the molecular formula C24H38N6O3 and a molecular weight of 458.61 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[5-[2-(cyclopropylamino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S)-1-[5-[2-(cyclopropylamino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 90052577 |
| Molecular Formula | C24H38N6O3 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | tert-butyl N-[(2S)-1-[5-[2-(cyclopropylamino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylcarbamate |
| SMILES | CCCNc1nc(NC2CC2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38N6O3/c1-7-14-25-20-18(16-27-22(29-20)28-19-12-13-19)11-9-8-10-15-26-21(31)17(2)30(6)23(32)33-24(3,4)5/h16-17,19H,7-8,10,12-15H2,1-6H3,(H,26,31)(H2,25,27,28,29)/t17-/m0/s1 |
| InChIKey | HMGDENYOPBVDJG-KRWDZBQOSA-N |
| XLogP | 3.38 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|