C29H40FN7O3 — CID 90053455
tert-butyl N-[(2S)-1-[5-[4-[cyclopropyl(propyl)amino]-2-[(2-fluoro-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylcarbamate (PubChem CID 90053455) has the molecular formula C29H40FN7O3 and a molecular weight of 553.68 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[5-[4-[cyclopropyl(propyl)amino]-2-[(2-fluoro-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S)-1-[5-[4-[cyclopropyl(propyl)amino]-2-[(2-fluoro-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 90053455 |
| Molecular Formula | C29H40FN7O3 |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | tert-butyl N-[(2S)-1-[5-[4-[cyclopropyl(propyl)amino]-2-[(2-fluoro-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylcarbamate |
| SMILES | CCCN(c1nc(Nc2ccnc(F)c2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C29H40FN7O3/c1-7-17-37(23-12-13-23)25-21(19-33-27(35-25)34-22-14-16-31-24(30)18-22)11-9-8-10-15-32-26(38)20(2)36(6)28(39)40-29(3,4)5/h14,16,18-20,23H,7-8,10,12-13,15,17H2,1-6H3,(H,32,38)(H,31,33,34,35)/t20-/m0/s1 |
| InChIKey | HSONSLXPPOYASD-FQEVSTJZSA-N |
| XLogP | 4.64 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|