C14H19ClN4O2 — CID 178023696
tert-butyl N-[(2S)-5-(2-amino-4-chloropyrimidin-5-yl)pent-4-yn-2-yl]carbamate (PubChem CID 178023696) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.79 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-(2-amino-4-chloropyrimidin-5-yl)pent-4-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-5-(2-amino-4-chloropyrimidin-5-yl)pent-4-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 178023696 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | tert-butyl N-[(2S)-5-(2-amino-4-chloropyrimidin-5-yl)pent-4-yn-2-yl]carbamate |
| SMILES | C[C@@H](CC#Cc1cnc(N)nc1Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19ClN4O2/c1-9(18-13(20)21-14(2,3)4)6-5-7-10-8-17-12(16)19-11(10)15/h8-9H,6H2,1-4H3,(H,18,20)(H2,16,17,19)/t9-/m0/s1 |
| InChIKey | YEDIPWLSXYQDTD-VIFPVBQESA-N |
| XLogP | 2.37 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|