C18H21ClF3NO3 — CID 90087052
tert-butyl N-[(2S,3S)-6-[4-chloro-2-(trifluoromethyl)phenyl]-3-hydroxyhex-5-yn-2-yl]carbamate (PubChem CID 90087052) has the molecular formula C18H21ClF3NO3 and a molecular weight of 391.82 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-6-[4-chloro-2-(trifluoromethyl)phenyl]-3-hydroxyhex-5-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-6-[4-chloro-2-(trifluoromethyl)phenyl]-3-hydroxyhex-5-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 90087052 |
| Molecular Formula | C18H21ClF3NO3 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | tert-butyl N-[(2S,3S)-6-[4-chloro-2-(trifluoromethyl)phenyl]-3-hydroxyhex-5-yn-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)[C@@H](O)CC#Cc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C18H21ClF3NO3/c1-11(23-16(25)26-17(2,3)4)15(24)7-5-6-12-8-9-13(19)10-14(12)18(20,21)22/h8-11,15,24H,7H2,1-4H3,(H,23,25)/t11-,15-/m0/s1 |
| InChIKey | KXNJXRVMVJBNHM-NHYWBVRUSA-N |
| XLogP | 4.37 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|