C15H17F4N3O2 — CID 178023621
tert-butyl N-[(2R)-5-(6-amino-4-fluoro-3-pyridinyl)-1,1,1-trifluoropent-4-yn-2-yl]carbamate (PubChem CID 178023621) has the molecular formula C15H17F4N3O2 and a molecular weight of 347.31 g/mol. Its IUPAC name is tert-butyl N-[(2R)-5-(6-amino-4-fluoro-3-pyridinyl)-1,1,1-trifluoropent-4-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-5-(6-amino-4-fluoro-3-pyridinyl)-1,1,1-trifluoropent-4-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 178023621 |
| Molecular Formula | C15H17F4N3O2 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | tert-butyl N-[(2R)-5-(6-amino-4-fluoro-3-pyridinyl)-1,1,1-trifluoropent-4-yn-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC#Cc1cnc(N)cc1F)C(F)(F)F |
| InChI | InChI=1S/C15H17F4N3O2/c1-14(2,3)24-13(23)22-11(15(17,18)19)6-4-5-9-8-21-12(20)7-10(9)16/h7-8,11H,6H2,1-3H3,(H2,20,21)(H,22,23)/t11-/m1/s1 |
| InChIKey | AQTNAJPXTFHQFA-LLVKDONJSA-N |
| XLogP | 3.00 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|