C16H25N5O2 — CID 178023719
tert-butyl N-[(2S)-5-[2,4-bis(methylamino)pyrimidin-5-yl]pent-4-yn-2-yl]carbamate (PubChem CID 178023719) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-[2,4-bis(methylamino)pyrimidin-5-yl]pent-4-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-5-[2,4-bis(methylamino)pyrimidin-5-yl]pent-4-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 178023719 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl N-[(2S)-5-[2,4-bis(methylamino)pyrimidin-5-yl]pent-4-yn-2-yl]carbamate |
| SMILES | CNc1ncc(C#CC[C@H](C)NC(=O)OC(C)(C)C)c(NC)n1 |
| InChI | InChI=1S/C16H25N5O2/c1-11(20-15(22)23-16(2,3)4)8-7-9-12-10-19-14(18-6)21-13(12)17-5/h10-11H,8H2,1-6H3,(H,20,22)(H2,17,18,19,21)/t11-/m0/s1 |
| InChIKey | RBPVUABLBOSUPI-NSHDSACASA-N |
| XLogP | 2.21 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|