C14H22N4O2 — CID 178023889
tert-butyl N-[(E,2S)-5-(2-aminopyrimidin-5-yl)pent-4-en-2-yl]carbamate (PubChem CID 178023889) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-5-(2-aminopyrimidin-5-yl)pent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S)-5-(2-aminopyrimidin-5-yl)pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 178023889 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | tert-butyl N-[(E,2S)-5-(2-aminopyrimidin-5-yl)pent-4-en-2-yl]carbamate |
| SMILES | C[C@@H](C/C=C/c1cnc(N)nc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N4O2/c1-10(18-13(19)20-14(2,3)4)6-5-7-11-8-16-12(15)17-9-11/h5,7-10H,6H2,1-4H3,(H,18,19)(H2,15,16,17)/b7-5+/t10-/m0/s1 |
| InChIKey | AIIHGMMSKOOVJH-STUBTGCMSA-N |
| XLogP | 2.38 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |