C17H22BrNO4 — CID 134900413
[(E)-3-(4-bromophenyl)prop-2-enyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 134900413) has the molecular formula C17H22BrNO4 and a molecular weight of 384.27 g/mol. Its IUPAC name is [(E)-3-(4-bromophenyl)prop-2-enyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [(E)-3-(4-bromophenyl)prop-2-enyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 134900413 |
| Molecular Formula | C17H22BrNO4 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | [(E)-3-(4-bromophenyl)prop-2-enyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)OC/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H22BrNO4/c1-12(19-16(21)23-17(2,3)4)15(20)22-11-5-6-13-7-9-14(18)10-8-13/h5-10,12H,11H2,1-4H3,(H,19,21)/b6-5+ |
| InChIKey | CBBNJFCZHZHEDE-AATRIKPKSA-N |
| XLogP | 3.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |