C17H24BrNO3 — CID 153448498
tert-butyl N-[(E)-1-(4-bromophenyl)-6-hydroxyhex-1-en-3-yl]carbamate (PubChem CID 153448498) has the molecular formula C17H24BrNO3 and a molecular weight of 370.29 g/mol. Its IUPAC name is tert-butyl N-[(E)-1-(4-bromophenyl)-6-hydroxyhex-1-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(E)-1-(4-bromophenyl)-6-hydroxyhex-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 153448498 |
| Molecular Formula | C17H24BrNO3 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | tert-butyl N-[(E)-1-(4-bromophenyl)-6-hydroxyhex-1-en-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(/C=C/c1ccc(Br)cc1)CCCO |
| InChI | InChI=1S/C17H24BrNO3/c1-17(2,3)22-16(21)19-15(5-4-12-20)11-8-13-6-9-14(18)10-7-13/h6-11,15,20H,4-5,12H2,1-3H3,(H,19,21)/b11-8+ |
| InChIKey | CLCWSLDDNQEMGN-DHZHZOJOSA-N |
| XLogP | 4.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |