C19H28BrNO2 — CID 67347167
tert-butyl 2-[[(E)-3-(4-bromophenyl)prop-2-enyl]amino]-4-methylpentanoate (PubChem CID 67347167) has the molecular formula C19H28BrNO2 and a molecular weight of 382.34 g/mol. Its IUPAC name is tert-butyl 2-[[(E)-3-(4-bromophenyl)prop-2-enyl]amino]-4-methylpentanoate.
| Compound Name | tert-butyl 2-[[(E)-3-(4-bromophenyl)prop-2-enyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 67347167 |
| Molecular Formula | C19H28BrNO2 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | tert-butyl 2-[[(E)-3-(4-bromophenyl)prop-2-enyl]amino]-4-methylpentanoate |
| SMILES | CC(C)CC(NC/C=C/c1ccc(Br)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28BrNO2/c1-14(2)13-17(18(22)23-19(3,4)5)21-12-6-7-15-8-10-16(20)11-9-15/h6-11,14,17,21H,12-13H2,1-5H3/b7-6+ |
| InChIKey | DZAQZUCAQAUHBQ-VOTSOKGWSA-N |
| XLogP | 4.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |