C22H28BrNO4S — CID 10767122
tert-butyl (2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-4-methylpentanoate (PubChem CID 10767122) has the molecular formula C22H28BrNO4S and a molecular weight of 482.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-4-methylpentanoate.
| Compound Name | tert-butyl (2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 10767122 |
| Molecular Formula | C22H28BrNO4S |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | tert-butyl (2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NS(=O)(=O)c1ccc(-c2ccc(Br)cc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H28BrNO4S/c1-15(2)14-20(21(25)28-22(3,4)5)24-29(26,27)19-12-8-17(9-13-19)16-6-10-18(23)11-7-16/h6-13,15,20,24H,14H2,1-5H3/t20-/m0/s1 |
| InChIKey | WGYATGGBPPMOGR-FQEVSTJZSA-N |
| XLogP | 5.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |