C18H32N6O2 — CID 140821899
tert-butyl N-[4-[[5-amino-2-(cyclopentylamino)pyrimidin-4-yl]amino]butan-2-yl]carbamate (PubChem CID 140821899) has the molecular formula C18H32N6O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is tert-butyl N-[4-[[5-amino-2-(cyclopentylamino)pyrimidin-4-yl]amino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[5-amino-2-(cyclopentylamino)pyrimidin-4-yl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140821899 |
| Molecular Formula | C18H32N6O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | tert-butyl N-[4-[[5-amino-2-(cyclopentylamino)pyrimidin-4-yl]amino]butan-2-yl]carbamate |
| SMILES | CC(CCNc1nc(NC2CCCC2)ncc1N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N6O2/c1-12(22-17(25)26-18(2,3)4)9-10-20-15-14(19)11-21-16(24-15)23-13-7-5-6-8-13/h11-13H,5-10,19H2,1-4H3,(H,22,25)(H2,20,21,23,24) |
| InChIKey | BUFVVUJHZUSCKE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |