C20H22ClN3O2 — CID 178024380
tert-butyl N-[(1R)-4-(6-amino-5-chloro-3-pyridinyl)-1-phenylbut-3-ynyl]carbamate (PubChem CID 178024380) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is tert-butyl N-[(1R)-4-(6-amino-5-chloro-3-pyridinyl)-1-phenylbut-3-ynyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-4-(6-amino-5-chloro-3-pyridinyl)-1-phenylbut-3-ynyl]carbamate |
|---|---|
| PubChem CID | 178024380 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | tert-butyl N-[(1R)-4-(6-amino-5-chloro-3-pyridinyl)-1-phenylbut-3-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC#Cc1cnc(N)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-20(2,3)26-19(25)24-17(15-9-5-4-6-10-15)11-7-8-14-12-16(21)18(22)23-13-14/h4-6,9-10,12-13,17H,11H2,1-3H3,(H2,22,23)(H,24,25)/t17-/m1/s1 |
| InChIKey | DZPKYOWRCMKCOH-QGZVFWFLSA-N |
| XLogP | 4.32 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|