C12H16ClIN4O2 — CID 138556745
[1-[(2-chloro-5-iodopyrimidin-4-yl)amino]cyclohexyl]methylcarbamic acid (PubChem CID 138556745) has the molecular formula C12H16ClIN4O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is [1-[(2-chloro-5-iodopyrimidin-4-yl)amino]cyclohexyl]methylcarbamic acid.
| Compound Name | [1-[(2-chloro-5-iodopyrimidin-4-yl)amino]cyclohexyl]methylcarbamic acid |
|---|---|
| PubChem CID | 138556745 |
| Molecular Formula | C12H16ClIN4O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | [1-[(2-chloro-5-iodopyrimidin-4-yl)amino]cyclohexyl]methylcarbamic acid |
| SMILES | O=C(O)NCC1(Nc2nc(Cl)ncc2I)CCCCC1 |
| InChI | InChI=1S/C12H16ClIN4O2/c13-10-15-6-8(14)9(17-10)18-12(7-16-11(19)20)4-2-1-3-5-12/h6,16H,1-5,7H2,(H,19,20)(H,15,17,18) |
| InChIKey | WMQDWQHXPPEBML-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|