C23H37ClN4O4 — CID 155260969
[[1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexyl]methylamino]-[(2-methylpropan-2-yl)oxy]methanol (PubChem CID 155260969) has the molecular formula C23H37ClN4O4 and a molecular weight of 469.03 g/mol. Its IUPAC name is [[1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexyl]methylamino]-[(2-methylpropan-2-yl)oxy]methanol.
| Compound Name | [[1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexyl]methylamino]-[(2-methylpropan-2-yl)oxy]methanol |
|---|---|
| PubChem CID | 155260969 |
| Molecular Formula | C23H37ClN4O4 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [[1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexyl]methylamino]-[(2-methylpropan-2-yl)oxy]methanol |
| SMILES | CCOC(C#Cc1cnc(Cl)nc1NC1(CNC(O)OC(C)(C)C)CCCCC1)OCC |
| InChI | InChI=1S/C23H37ClN4O4/c1-6-30-18(31-7-2)12-11-17-15-25-20(24)27-19(17)28-23(13-9-8-10-14-23)16-26-21(29)32-22(3,4)5/h15,18,21,26,29H,6-10,13-14,16H2,1-5H3,(H,25,27,28) |
| InChIKey | BOFDFAYQQHYYRN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|