C20H23ClN4O4 — CID 146574503
[(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid (PubChem CID 146574503) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid.
| Compound Name | [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid |
|---|---|
| PubChem CID | 146574503 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid |
| SMILES | CCOC(C#Cc1cnc(Cl)nc1N[C@H](CNC(=O)O)c1ccccc1)OCC |
| InChI | InChI=1S/C20H23ClN4O4/c1-3-28-17(29-4-2)11-10-15-12-22-19(21)25-18(15)24-16(13-23-20(26)27)14-8-6-5-7-9-14/h5-9,12,16-17,23H,3-4,13H2,1-2H3,(H,26,27)(H,22,24,25)/t16-/m1/s1 |
| InChIKey | WDJHCDYZHFFLJC-MRXNPFEDSA-N |
| XLogP | 3.30 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|