About [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid
[(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid (PubChem CID 146574503) has the molecular formula C20H23ClN4O4
and a molecular weight of 418.88 g/mol. Its IUPAC name is [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid.
Molecular Properties
| Compound Name | [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid |
| PubChem CID | 146574503 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid |
| SMILES | CCOC(C#Cc1cnc(Cl)nc1N[C@H](CNC(=O)O)c1ccccc1)OCC |
| InChI | InChI=1S/C20H23ClN4O4/c1-3-28-17(29-4-2)11-10-15-12-22-19(21)25-18(15)24-16(13-23-20(26)27)14-8-6-5-7-9-14/h5-9,12,16-17,23H,3-4,13H2,1-2H3,(H,26,27)(H,22,24,25)/t16-/m1/s1 |
| InChIKey | WDJHCDYZHFFLJC-MRXNPFEDSA-N |
| XLogP | 3.30 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid?
The IUPAC name of [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid (CID 146574503) is [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid.
What is the SMILES notation for [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid?
The canonical SMILES for [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid is CCOC(C#Cc1cnc(Cl)nc1N[C@H](CNC(=O)O)c1ccccc1)OCC.
What is the InChIKey of [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid?
The InChIKey is WDJHCDYZHFFLJC-MRXNPFEDSA-N. The full InChI is InChI=1S/C20H23ClN4O4/c1-3-28-17(29-4-2)11-10-15-12-22-19(21)25-18(15)24-16(13-23-20(26)27)14-8-6-5-7-9-14/h5-9,12,16-17,23H,3-4,13H2,1-2H3,(H,26,27)(H,22,24,25)/t16-/m1/s1.
What are the key properties of [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid?
[(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid has a molecular weight of 418.88 g/mol, XLogP of 3.30, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-2-phenylethyl]carbamic acid is sourced from PubChem (CID 146574503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).