C17H20BrClN4O2 — CID 86695599
tert-butyl N-[(2S)-2-[(5-bromo-2-chloropyrimidin-4-yl)amino]-2-phenylethyl]carbamate (PubChem CID 86695599) has the molecular formula C17H20BrClN4O2 and a molecular weight of 427.73 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[(5-bromo-2-chloropyrimidin-4-yl)amino]-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[(5-bromo-2-chloropyrimidin-4-yl)amino]-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 86695599 |
| Molecular Formula | C17H20BrClN4O2 |
| Molecular Weight | 427.73 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | tert-butyl N-[(2S)-2-[(5-bromo-2-chloropyrimidin-4-yl)amino]-2-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](Nc1nc(Cl)ncc1Br)c1ccccc1 |
| InChI | InChI=1S/C17H20BrClN4O2/c1-17(2,3)25-16(24)21-10-13(11-7-5-4-6-8-11)22-14-12(18)9-20-15(19)23-14/h4-9,13H,10H2,1-3H3,(H,21,24)(H,20,22,23)/t13-/m1/s1 |
| InChIKey | CQNLJJZVYDHYRK-CYBMUJFWSA-N |
| XLogP | 4.57 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.73 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |