C18H27ClN4O4 — CID 146574501
[(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-3,3-dimethylbutyl]carbamic acid (PubChem CID 146574501) has the molecular formula C18H27ClN4O4 and a molecular weight of 398.89 g/mol. Its IUPAC name is [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-3,3-dimethylbutyl]carbamic acid.
| Compound Name | [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-3,3-dimethylbutyl]carbamic acid |
|---|---|
| PubChem CID | 146574501 |
| Molecular Formula | C18H27ClN4O4 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [(2S)-2-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]-3,3-dimethylbutyl]carbamic acid |
| SMILES | CCOC(C#Cc1cnc(Cl)nc1N[C@H](CNC(=O)O)C(C)(C)C)OCC |
| InChI | InChI=1S/C18H27ClN4O4/c1-6-26-14(27-7-2)9-8-12-10-20-16(19)23-15(12)22-13(18(3,4)5)11-21-17(24)25/h10,13-14,21H,6-7,11H2,1-5H3,(H,24,25)(H,20,22,23)/t13-/m1/s1 |
| InChIKey | ZISYUPCPYCWRGS-CYBMUJFWSA-N |
| XLogP | 2.97 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|