C9H10BrN3 — CID 103578187
5-bromo-N-pent-1-yn-3-ylpyrimidin-2-amine (PubChem CID 103578187) has the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. Its IUPAC name is 5-bromo-N-pent-1-yn-3-ylpyrimidin-2-amine.
| Compound Name | 5-bromo-N-pent-1-yn-3-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 103578187 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 5-bromo-N-pent-1-yn-3-ylpyrimidin-2-amine |
| SMILES | C#CC(CC)Nc1ncc(Br)cn1 |
| InChI | InChI=1S/C9H10BrN3/c1-3-8(4-2)13-9-11-5-7(10)6-12-9/h1,5-6,8H,4H2,2H3,(H,11,12,13) |
| InChIKey | WGNPECOBGTWAET-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|