C10H10F2N2 — CID 106231403
3,5-difluoro-N-pent-1-yn-3-ylpyridin-2-amine (PubChem CID 106231403) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is 3,5-difluoro-N-pent-1-yn-3-ylpyridin-2-amine.
| Compound Name | 3,5-difluoro-N-pent-1-yn-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 106231403 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 3,5-difluoro-N-pent-1-yn-3-ylpyridin-2-amine |
| SMILES | C#CC(CC)Nc1ncc(F)cc1F |
| InChI | InChI=1S/C10H10F2N2/c1-3-8(4-2)14-10-9(12)5-7(11)6-13-10/h1,5-6,8H,4H2,2H3,(H,13,14) |
| InChIKey | VHPIYCSZBVVRIU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|