C13H10Cl2F2N2 — CID 112675534
N-[1-(2,4-dichlorophenyl)ethyl]-3,5-difluoropyridin-2-amine (PubChem CID 112675534) has the molecular formula C13H10Cl2F2N2 and a molecular weight of 303.14 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-3,5-difluoropyridin-2-amine.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-3,5-difluoropyridin-2-amine |
|---|---|
| PubChem CID | 112675534 |
| Molecular Formula | C13H10Cl2F2N2 |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-3,5-difluoropyridin-2-amine |
| SMILES | CC(Nc1ncc(F)cc1F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl2F2N2/c1-7(10-3-2-8(14)4-11(10)15)19-13-12(17)5-9(16)6-18-13/h2-7H,1H3,(H,18,19) |
| InChIKey | FCLMYFIRTLCKAA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |