C10H13N3 — CID 106233105
2-N-pent-1-yn-3-ylpyridine-2,4-diamine (PubChem CID 106233105) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is 2-N-pent-1-yn-3-ylpyridine-2,4-diamine.
| Compound Name | 2-N-pent-1-yn-3-ylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 106233105 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-N-pent-1-yn-3-ylpyridine-2,4-diamine |
| SMILES | C#CC(CC)Nc1cc(N)ccn1 |
| InChI | InChI=1S/C10H13N3/c1-3-9(4-2)13-10-7-8(11)5-6-12-10/h1,5-7,9H,4H2,2H3,(H3,11,12,13) |
| InChIKey | WVPUHGRIASOXHU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|