C11H16N4 — CID 106231260
2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine (PubChem CID 106231260) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106231260 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine |
| SMILES | C#CC(CC)Nc1ccnc(N(C)C)n1 |
| InChI | InChI=1S/C11H16N4/c1-5-9(6-2)13-10-7-8-12-11(14-10)15(3)4/h1,7-9H,6H2,2-4H3,(H,12,13,14) |
| InChIKey | WUYRNCIZPYOCGT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|