About 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine
2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine (PubChem CID 106231260) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine |
| PubChem CID | 106231260 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine |
| SMILES | C#CC(CC)Nc1ccnc(N(C)C)n1 |
| InChI | InChI=1S/C11H16N4/c1-5-9(6-2)13-10-7-8-12-11(14-10)15(3)4/h1,7-9H,6H2,2-4H3,(H,12,13,14) |
| InChIKey | WUYRNCIZPYOCGT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine?
The IUPAC name of 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine (CID 106231260) is 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine.
What is the SMILES notation for 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine?
The canonical SMILES for 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine is C#CC(CC)Nc1ccnc(N(C)C)n1.
What is the InChIKey of 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine?
The InChIKey is WUYRNCIZPYOCGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-5-9(6-2)13-10-7-8-12-11(14-10)15(3)4/h1,7-9H,6H2,2-4H3,(H,12,13,14).
What are the key properties of 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine?
2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine has a molecular weight of 204.28 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-dimethyl-4-N-pent-1-yn-3-ylpyrimidine-2,4-diamine is sourced from PubChem (CID 106231260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).