C14H23N3 — CID 55069644
2-N-(1-cyclohexylpropyl)pyridine-2,4-diamine (PubChem CID 55069644) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-N-(1-cyclohexylpropyl)pyridine-2,4-diamine.
| Compound Name | 2-N-(1-cyclohexylpropyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 55069644 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-N-(1-cyclohexylpropyl)pyridine-2,4-diamine |
| SMILES | CCC(Nc1cc(N)ccn1)C1CCCCC1 |
| InChI | InChI=1S/C14H23N3/c1-2-13(11-6-4-3-5-7-11)17-14-10-12(15)8-9-16-14/h8-11,13H,2-7H2,1H3,(H3,15,16,17) |
| InChIKey | UUDBYTQZSJPOIN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |