C16H25BrN2O2 — CID 114895437
5-bromo-2-[5-(diethylamino)pentan-2-ylamino]benzoic acid (PubChem CID 114895437) has the molecular formula C16H25BrN2O2 and a molecular weight of 357.29 g/mol. Its IUPAC name is 5-bromo-2-[5-(diethylamino)pentan-2-ylamino]benzoic acid.
| Compound Name | 5-bromo-2-[5-(diethylamino)pentan-2-ylamino]benzoic acid |
|---|---|
| PubChem CID | 114895437 |
| Molecular Formula | C16H25BrN2O2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 5-bromo-2-[5-(diethylamino)pentan-2-ylamino]benzoic acid |
| SMILES | CCN(CC)CCCC(C)Nc1ccc(Br)cc1C(=O)O |
| InChI | InChI=1S/C16H25BrN2O2/c1-4-19(5-2)10-6-7-12(3)18-15-9-8-13(17)11-14(15)16(20)21/h8-9,11-12,18H,4-7,10H2,1-3H3,(H,20,21) |
| InChIKey | RPVWQTQOPGKXDH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |