C26H28N2O2 — CID 141389815
(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-2-phenylquinolin-4-yl)methanol (PubChem CID 141389815) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is (R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-2-phenylquinolin-4-yl)methanol.
| Compound Name | (R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-2-phenylquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 141389815 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-2-phenylquinolin-4-yl)methanol |
| SMILES | C=C[C@H]1CN2CCC1C[C@H]2[C@H](O)c1cc(-c2ccccc2)nc2ccc(OC)cc12 |
| InChI | InChI=1S/C26H28N2O2/c1-3-17-16-28-12-11-19(17)13-25(28)26(29)22-15-24(18-7-5-4-6-8-18)27-23-10-9-20(30-2)14-21(22)23/h3-10,14-15,17,19,25-26,29H,1,11-13,16H2,2H3/t17-,19?,25-,26+/m0/s1 |
| InChIKey | HIXAAZGULRMCOX-ZTOHDJCNSA-N |
| XLogP | 4.84 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|