C26H28N2O4S — CID 166447557
(R)-[2-(benzenesulfonyl)-6-methoxyquinolin-4-yl]-[(2R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol (PubChem CID 166447557) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is (R)-[2-(benzenesulfonyl)-6-methoxyquinolin-4-yl]-[(2R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol.
| Compound Name | (R)-[2-(benzenesulfonyl)-6-methoxyquinolin-4-yl]-[(2R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol |
|---|---|
| PubChem CID | 166447557 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (R)-[2-(benzenesulfonyl)-6-methoxyquinolin-4-yl]-[(2R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol |
| SMILES | C=C[C@H]1CN2CCC1C[C@@H]2[C@H](O)c1cc(S(=O)(=O)c2ccccc2)nc2ccc(OC)cc12 |
| InChI | InChI=1S/C26H28N2O4S/c1-3-17-16-28-12-11-18(17)13-24(28)26(29)22-15-25(33(30,31)20-7-5-4-6-8-20)27-23-10-9-19(32-2)14-21(22)23/h3-10,14-15,17-18,24,26,29H,1,11-13,16H2,2H3/t17-,18?,24+,26+/m0/s1 |
| InChIKey | YWHYFHYXVRGZAN-OSMGIVAKSA-N |
| XLogP | 4.01 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|