C29H29N3O2 — CID 143470916
(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxy-2-quinolin-2-ylquinolin-4-yl)methanol (PubChem CID 143470916) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is (R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxy-2-quinolin-2-ylquinolin-4-yl)methanol.
| Compound Name | (R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxy-2-quinolin-2-ylquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 143470916 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | (R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxy-2-quinolin-2-ylquinolin-4-yl)methanol |
| SMILES | C=CC1CN2CCC1CC2[C@H](O)c1cc(-c2ccc3ccccc3n2)nc2ccc(OC)cc12 |
| InChI | InChI=1S/C29H29N3O2/c1-3-18-17-32-13-12-20(18)14-28(32)29(33)23-16-27(31-25-11-9-21(34-2)15-22(23)25)26-10-8-19-6-4-5-7-24(19)30-26/h3-11,15-16,18,20,28-29,33H,1,12-14,17H2,2H3/t18?,20?,28?,29-/m1/s1 |
| InChIKey | YLRYBHCXXUCWHW-DVSFQJNLSA-N |
| XLogP | 5.39 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|