C20H24N2O6S — CID 140604544
[4-[(S)-[(2R,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-6-methoxyquinolin-2-yl] hydrogen sulfate (PubChem CID 140604544) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is [4-[(S)-[(2R,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-6-methoxyquinolin-2-yl] hydrogen sulfate.
| Compound Name | [4-[(S)-[(2R,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-6-methoxyquinolin-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 140604544 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [4-[(S)-[(2R,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-6-methoxyquinolin-2-yl] hydrogen sulfate |
| SMILES | C=C[C@H]1CN2CC[C@@H]1C[C@@H]2[C@@H](O)c1cc(OS(=O)(=O)O)nc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H24N2O6S/c1-3-12-11-22-7-6-13(12)8-18(22)20(23)16-10-19(28-29(24,25)26)21-17-5-4-14(27-2)9-15(16)17/h3-5,9-10,12-13,18,20,23H,1,6-8,11H2,2H3,(H,24,25,26)/t12-,13+,18+,20-/m0/s1 |
| InChIKey | SJKXAYBCLDBNNN-ZLSUJJLUSA-N |
| XLogP | 2.35 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|