C25H32N2O4 — CID 142160393
tert-butyl 4-[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-6-methoxyquinoline-2-carboxylate (PubChem CID 142160393) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is tert-butyl 4-[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-6-methoxyquinoline-2-carboxylate.
| Compound Name | tert-butyl 4-[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-6-methoxyquinoline-2-carboxylate |
|---|---|
| PubChem CID | 142160393 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | tert-butyl 4-[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-6-methoxyquinoline-2-carboxylate |
| SMILES | C=C[C@H]1CN2CCC1C[C@H]2[C@H](O)c1cc(C(=O)OC(C)(C)C)nc2ccc(OC)cc12 |
| InChI | InChI=1S/C25H32N2O4/c1-6-15-14-27-10-9-16(15)11-22(27)23(28)19-13-21(24(29)31-25(2,3)4)26-20-8-7-17(30-5)12-18(19)20/h6-8,12-13,15-16,22-23,28H,1,9-11,14H2,2-5H3/t15-,16?,22-,23+/m0/s1 |
| InChIKey | DFKQXMMFRVJPPP-CJZWXTEZSA-N |
| XLogP | 4.13 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|