C19H18N2O3S — CID 95185798
(2R)-2-amino-3-(6-methoxy-2-phenylquinolin-4-yl)sulfanylpropanoic acid (PubChem CID 95185798) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is (2R)-2-amino-3-(6-methoxy-2-phenylquinolin-4-yl)sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-(6-methoxy-2-phenylquinolin-4-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 95185798 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (2R)-2-amino-3-(6-methoxy-2-phenylquinolin-4-yl)sulfanylpropanoic acid |
| SMILES | COc1ccc2nc(-c3ccccc3)cc(SC[C@H](N)C(=O)O)c2c1 |
| InChI | InChI=1S/C19H18N2O3S/c1-24-13-7-8-16-14(9-13)18(25-11-15(20)19(22)23)10-17(21-16)12-5-3-2-4-6-12/h2-10,15H,11,20H2,1H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | RRMSUEYOXBNEGC-HNNXBMFYSA-N |
| XLogP | 3.41 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |