C18H20N2O6S — CID 22109432
4-[[1-carboxy-2-(6-methoxy-2-methylquinolin-4-yl)sulfanylethyl]amino]-4-oxobutanoic acid (PubChem CID 22109432) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is 4-[[1-carboxy-2-(6-methoxy-2-methylquinolin-4-yl)sulfanylethyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[1-carboxy-2-(6-methoxy-2-methylquinolin-4-yl)sulfanylethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22109432 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 4-[[1-carboxy-2-(6-methoxy-2-methylquinolin-4-yl)sulfanylethyl]amino]-4-oxobutanoic acid |
| SMILES | COc1ccc2nc(C)cc(SCC(NC(=O)CCC(=O)O)C(=O)O)c2c1 |
| InChI | InChI=1S/C18H20N2O6S/c1-10-7-15(12-8-11(26-2)3-4-13(12)19-10)27-9-14(18(24)25)20-16(21)5-6-17(22)23/h3-4,7-8,14H,5-6,9H2,1-2H3,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | UOJKIMHRYZOIEF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |