C21H21N3O4S — CID 3168483
N'-[2-(6-methoxy-2-methylquinolin-4-yl)sulfanylacetyl]-2-phenoxyacetohydrazide (PubChem CID 3168483) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is N'-[2-(6-methoxy-2-methylquinolin-4-yl)sulfanylacetyl]-2-phenoxyacetohydrazide.
| Compound Name | N'-[2-(6-methoxy-2-methylquinolin-4-yl)sulfanylacetyl]-2-phenoxyacetohydrazide |
|---|---|
| PubChem CID | 3168483 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N'-[2-(6-methoxy-2-methylquinolin-4-yl)sulfanylacetyl]-2-phenoxyacetohydrazide |
| SMILES | COc1ccc2nc(C)cc(SCC(=O)NNC(=O)COc3ccccc3)c2c1 |
| InChI | InChI=1S/C21H21N3O4S/c1-14-10-19(17-11-16(27-2)8-9-18(17)22-14)29-13-21(26)24-23-20(25)12-28-15-6-4-3-5-7-15/h3-11H,12-13H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | CZKSZVBYPCBSHS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|