C17H24ClN3 — CID 58467346
N-(7-chloro-3-methylquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 58467346) has the molecular formula C17H24ClN3 and a molecular weight of 305.85 g/mol. Its IUPAC name is N-(7-chloro-3-methylquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(7-chloro-3-methylquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 58467346 |
| Molecular Formula | C17H24ClN3 |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N-(7-chloro-3-methylquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1c(C)cnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C17H24ClN3/c1-4-21(5-2)10-6-9-19-17-13(3)12-20-16-11-14(18)7-8-15(16)17/h7-8,11-12H,4-6,9-10H2,1-3H3,(H,19,20) |
| InChIKey | LUUDLKFULZJHPH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|