C16H21ClN2O — CID 154130691
2-(7-chloro-4-methylquinolin-2-yl)oxy-N,N-diethylethanamine (PubChem CID 154130691) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-(7-chloro-4-methylquinolin-2-yl)oxy-N,N-diethylethanamine.
| Compound Name | 2-(7-chloro-4-methylquinolin-2-yl)oxy-N,N-diethylethanamine |
|---|---|
| PubChem CID | 154130691 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(7-chloro-4-methylquinolin-2-yl)oxy-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1cc(C)c2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C16H21ClN2O/c1-4-19(5-2)8-9-20-16-10-12(3)14-7-6-13(17)11-15(14)18-16/h6-7,10-11H,4-5,8-9H2,1-3H3 |
| InChIKey | OWWWXEBPFWNPOG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |