C18H22N4O3 — CID 3305931
2-[2-(diethylamino)ethoxy]-7-methoxypyridazino[6,1-b]quinazolin-10-one (PubChem CID 3305931) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethoxy]-7-methoxypyridazino[6,1-b]quinazolin-10-one.
| Compound Name | 2-[2-(diethylamino)ethoxy]-7-methoxypyridazino[6,1-b]quinazolin-10-one |
|---|---|
| PubChem CID | 3305931 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[2-(diethylamino)ethoxy]-7-methoxypyridazino[6,1-b]quinazolin-10-one |
| SMILES | CCN(CC)CCOc1ccc2nc3cc(OC)ccc3c(=O)n2n1 |
| InChI | InChI=1S/C18H22N4O3/c1-4-21(5-2)10-11-25-17-9-8-16-19-15-12-13(24-3)6-7-14(15)18(23)22(16)20-17/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | IOARVVZNDSADRA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|