C32H44BrNO2 — CID 98524912
[(1S)-1-(6-bromophenanthren-9-yl)-2-(diheptylamino)ethyl] acetate (PubChem CID 98524912) has the molecular formula C32H44BrNO2 and a molecular weight of 554.61 g/mol. Its IUPAC name is [(1S)-1-(6-bromophenanthren-9-yl)-2-(diheptylamino)ethyl] acetate.
| Compound Name | [(1S)-1-(6-bromophenanthren-9-yl)-2-(diheptylamino)ethyl] acetate |
|---|---|
| PubChem CID | 98524912 |
| Molecular Formula | C32H44BrNO2 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | [(1S)-1-(6-bromophenanthren-9-yl)-2-(diheptylamino)ethyl] acetate |
| SMILES | CCCCCCCN(CCCCCCC)C[C@@H](OC(C)=O)c1cc2ccccc2c2cc(Br)ccc12 |
| InChI | InChI=1S/C32H44BrNO2/c1-4-6-8-10-14-20-34(21-15-11-9-7-5-2)24-32(36-25(3)35)31-22-26-16-12-13-17-28(26)30-23-27(33)18-19-29(30)31/h12-13,16-19,22-23,32H,4-11,14-15,20-21,24H2,1-3H3/t32-/m1/s1 |
| InChIKey | XDYMXTQMKVYQCF-JGCGQSQUSA-N |
| XLogP | 9.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|