C22H35NO5S — CID 173398297
N,N-dibutylbutan-1-amine;2,3-dihydroxynaphthalene-1-sulfonic acid (PubChem CID 173398297) has the molecular formula C22H35NO5S and a molecular weight of 425.59 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;2,3-dihydroxynaphthalene-1-sulfonic acid.
| Compound Name | N,N-dibutylbutan-1-amine;2,3-dihydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 173398297 |
| Molecular Formula | C22H35NO5S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | N,N-dibutylbutan-1-amine;2,3-dihydroxynaphthalene-1-sulfonic acid |
| SMILES | CCCCN(CCCC)CCCC.O=S(=O)(O)c1c(O)c(O)cc2ccccc12 |
| InChI | InChI=1S/C12H27N.C10H8O5S/c1-4-7-10-13(11-8-5-2)12-9-6-3;11-8-5-6-3-1-2-4-7(6)10(9(8)12)16(13,14)15/h4-12H2,1-3H3;1-5,11-12H,(H,13,14,15) |
| InChIKey | ZXWLRZJZGPGLIK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|