C38H54BrNO7 — CID 614599
2-[1-(6-bromophenanthren-9-yl)-2-(diheptylamino)ethoxy]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol (PubChem CID 614599) has the molecular formula C38H54BrNO7 and a molecular weight of 716.75 g/mol. Its IUPAC name is 2-[1-(6-bromophenanthren-9-yl)-2-(diheptylamino)ethoxy]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol.
| Compound Name | 2-[1-(6-bromophenanthren-9-yl)-2-(diheptylamino)ethoxy]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol |
|---|---|
| PubChem CID | 614599 |
| Molecular Formula | C38H54BrNO7 |
| Molecular Weight | 716.75 g/mol |
| Exact Mass | 715.31 |
| IUPAC Name | 2-[1-(6-bromophenanthren-9-yl)-2-(diheptylamino)ethoxy]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol |
| SMILES | CCCCCCCN(CCCCCCC)CC(OC1(C)OC2OC(CO)C(O)C(O)C2O1)c1cc2ccccc2c2cc(Br)ccc12 |
| InChI | InChI=1S/C38H54BrNO7/c1-4-6-8-10-14-20-40(21-15-11-9-7-5-2)24-32(45-38(3)46-36-35(43)34(42)33(25-41)44-37(36)47-38)31-22-26-16-12-13-17-28(26)30-23-27(39)18-19-29(30)31/h12-13,16-19,22-23,32-37,41-43H,4-11,14-15,20-21,24-25H2,1-3H3 |
| InChIKey | QRYAMKBXQHITER-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.75 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|