C16H15FN2 — CID 94600297
2-[[(R)-(4-fluorophenyl)-phenylmethyl]-methylamino]acetonitrile (PubChem CID 94600297) has the molecular formula C16H15FN2 and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-[[(R)-(4-fluorophenyl)-phenylmethyl]-methylamino]acetonitrile.
| Compound Name | 2-[[(R)-(4-fluorophenyl)-phenylmethyl]-methylamino]acetonitrile |
|---|---|
| PubChem CID | 94600297 |
| Molecular Formula | C16H15FN2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[[(R)-(4-fluorophenyl)-phenylmethyl]-methylamino]acetonitrile |
| SMILES | CN(CC#N)[C@H](c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN2/c1-19(12-11-18)16(13-5-3-2-4-6-13)14-7-9-15(17)10-8-14/h2-10,16H,12H2,1H3/t16-/m1/s1 |
| InChIKey | MJVOHNDBGBXGEZ-MRXNPFEDSA-N |
| XLogP | 3.37 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|