C11H12F2N2 — CID 129488563
2-[[(1S)-1-(2,4-difluorophenyl)ethyl]-methylamino]acetonitrile (PubChem CID 129488563) has the molecular formula C11H12F2N2 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-[[(1S)-1-(2,4-difluorophenyl)ethyl]-methylamino]acetonitrile.
| Compound Name | 2-[[(1S)-1-(2,4-difluorophenyl)ethyl]-methylamino]acetonitrile |
|---|---|
| PubChem CID | 129488563 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-[[(1S)-1-(2,4-difluorophenyl)ethyl]-methylamino]acetonitrile |
| SMILES | C[C@@H](c1ccc(F)cc1F)N(C)CC#N |
| InChI | InChI=1S/C11H12F2N2/c1-8(15(2)6-5-14)10-4-3-9(12)7-11(10)13/h3-4,7-8H,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | GZFSUGSVYIZLSA-QMMMGPOBSA-N |
| XLogP | 2.48 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|