C21H26N2O2 — CID 15649907
2,4-bis(2,2-dimethylpropanoyl)-3-phenylpentanedinitrile (PubChem CID 15649907) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2,4-bis(2,2-dimethylpropanoyl)-3-phenylpentanedinitrile.
| Compound Name | 2,4-bis(2,2-dimethylpropanoyl)-3-phenylpentanedinitrile |
|---|---|
| PubChem CID | 15649907 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2,4-bis(2,2-dimethylpropanoyl)-3-phenylpentanedinitrile |
| SMILES | CC(C)(C)C(=O)C(C#N)C(c1ccccc1)C(C#N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H26N2O2/c1-20(2,3)18(24)15(12-22)17(14-10-8-7-9-11-14)16(13-23)19(25)21(4,5)6/h7-11,15-17H,1-6H3 |
| InChIKey | CPYKSVKGSKMTGC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |