C21H17N — CID 10039481
4-(1,2-diphenylethyl)benzonitrile (PubChem CID 10039481) has the molecular formula C21H17N and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-(1,2-diphenylethyl)benzonitrile.
| Compound Name | 4-(1,2-diphenylethyl)benzonitrile |
|---|---|
| PubChem CID | 10039481 |
| Molecular Formula | C21H17N |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-(1,2-diphenylethyl)benzonitrile |
| SMILES | N#Cc1ccc(C(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17N/c22-16-18-11-13-20(14-12-18)21(19-9-5-2-6-10-19)15-17-7-3-1-4-8-17/h1-14,21H,15H2 |
| InChIKey | BSZNVUYIDVUXHR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |