C9H7Br2N — CID 147919374
4-(1,2-dibromoethyl)benzonitrile (PubChem CID 147919374) has the molecular formula C9H7Br2N and a molecular weight of 288.97 g/mol. Its IUPAC name is 4-(1,2-dibromoethyl)benzonitrile.
| Compound Name | 4-(1,2-dibromoethyl)benzonitrile |
|---|---|
| PubChem CID | 147919374 |
| Molecular Formula | C9H7Br2N |
| Molecular Weight | 288.97 g/mol |
| Exact Mass | 286.89 |
| IUPAC Name | 4-(1,2-dibromoethyl)benzonitrile |
| SMILES | N#Cc1ccc(C(Br)CBr)cc1 |
| InChI | InChI=1S/C9H7Br2N/c10-5-9(11)8-3-1-7(6-12)2-4-8/h1-4,9H,5H2 |
| InChIKey | IHSJLSUZAFEBDT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.97 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|