C18H10BrN — CID 122449091
4-[5-(4-bromophenyl)penta-1,4-diynyl]benzonitrile (PubChem CID 122449091) has the molecular formula C18H10BrN and a molecular weight of 320.19 g/mol. Its IUPAC name is 4-[5-(4-bromophenyl)penta-1,4-diynyl]benzonitrile.
| Compound Name | 4-[5-(4-bromophenyl)penta-1,4-diynyl]benzonitrile |
|---|---|
| PubChem CID | 122449091 |
| Molecular Formula | C18H10BrN |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 4-[5-(4-bromophenyl)penta-1,4-diynyl]benzonitrile |
| SMILES | N#Cc1ccc(C#CCC#Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C18H10BrN/c19-18-12-10-16(11-13-18)5-3-1-2-4-15-6-8-17(14-20)9-7-15/h6-13H,1H2 |
| InChIKey | SSCMAYNXRZTVHS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|