C25H18N2 — CID 10497783
2-[(E)-2-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]benzene-1,4-dicarbonitrile (PubChem CID 10497783) has the molecular formula C25H18N2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[(E)-2-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]benzene-1,4-dicarbonitrile.
| Compound Name | 2-[(E)-2-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 10497783 |
| Molecular Formula | C25H18N2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-[(E)-2-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]benzene-1,4-dicarbonitrile |
| SMILES | Cc1ccc(/C=C/c2ccc(/C=C/c3cc(C#N)ccc3C#N)cc2)cc1 |
| InChI | InChI=1S/C25H18N2/c1-19-2-4-20(5-3-19)6-7-21-8-10-22(11-9-21)12-14-24-16-23(17-26)13-15-25(24)18-27/h2-16H,1H3/b7-6+,14-12+ |
| InChIKey | DKTRPKIAHYIVGY-CKRYPDTRSA-N |
| XLogP | 6.08 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|